C29H33N5O4 — CID 143371154
1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-phenoxyphenyl)urea;ethane (PubChem CID 143371154) has the molecular formula C29H33N5O4 and a molecular weight of 515.61 g/mol. Its IUPAC name is 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-phenoxyphenyl)urea;ethane.
| Compound Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-phenoxyphenyl)urea;ethane |
|---|---|
| PubChem CID | 143371154 |
| Molecular Formula | C29H33N5O4 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | 1-[1-(6,7-dimethoxyquinazolin-4-yl)pyrrolidin-3-yl]-3-(4-phenoxyphenyl)urea;ethane |
| SMILES | CC.COc1cc2ncnc(N3CCC(NC(=O)Nc4ccc(Oc5ccccc5)cc4)C3)c2cc1OC |
| InChI | InChI=1S/C27H27N5O4.C2H6/c1-34-24-14-22-23(15-25(24)35-2)28-17-29-26(22)32-13-12-19(16-32)31-27(33)30-18-8-10-21(11-9-18)36-20-6-4-3-5-7-20;1-2/h3-11,14-15,17,19H,12-13,16H2,1-2H3,(H2,30,31,33);1-2H3 |
| InChIKey | ZIPKJDKEVPWMOJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |