C31H35N5O6 — CID 10166902
4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-(4-phenoxyphenyl)piperazine-1-carboxamide (PubChem CID 10166902) has the molecular formula C31H35N5O6 and a molecular weight of 573.65 g/mol. Its IUPAC name is 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-(4-phenoxyphenyl)piperazine-1-carboxamide.
| Compound Name | 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-(4-phenoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 10166902 |
| Molecular Formula | C31H35N5O6 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.26 |
| IUPAC Name | 4-[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]-N-(4-phenoxyphenyl)piperazine-1-carboxamide |
| SMILES | COCCOc1cc2ncnc(N3CCN(C(=O)Nc4ccc(Oc5ccccc5)cc4)CC3)c2cc1OCCOC |
| InChI | InChI=1S/C31H35N5O6/c1-38-16-18-40-28-20-26-27(21-29(28)41-19-17-39-2)32-22-33-30(26)35-12-14-36(15-13-35)31(37)34-23-8-10-25(11-9-23)42-24-6-4-3-5-7-24/h3-11,20-22H,12-19H2,1-2H3,(H,34,37) |
| InChIKey | UDXGWXKIXRVGSP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|