C25H31N5O4 — CID 22707356
N-(4-butoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide (PubChem CID 22707356) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-(4-butoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-(4-butoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 22707356 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | N-(4-butoxyphenyl)-4-(6,7-dimethoxyquinazolin-4-yl)piperazine-1-carboxamide |
| SMILES | CCCCOc1ccc(NC(=O)N2CCN(c3ncnc4cc(OC)c(OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H31N5O4/c1-4-5-14-34-19-8-6-18(7-9-19)28-25(31)30-12-10-29(11-13-30)24-20-15-22(32-2)23(33-3)16-21(20)26-17-27-24/h6-9,15-17H,4-5,10-14H2,1-3H3,(H,28,31) |
| InChIKey | NDAWKJOUHGRPPJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|