C29H30N4O4 — CID 58739019
1-[(3S)-1-benzylpyrrolidin-3-yl]-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea (PubChem CID 58739019) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 1-[(3S)-1-benzylpyrrolidin-3-yl]-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea.
| Compound Name | 1-[(3S)-1-benzylpyrrolidin-3-yl]-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea |
|---|---|
| PubChem CID | 58739019 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-[(3S)-1-benzylpyrrolidin-3-yl]-3-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]urea |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)N[C@H]4CCN(Cc5ccccc5)C4)cc3)c2cc1OC |
| InChI | InChI=1S/C29H30N4O4/c1-35-27-16-24-25(17-28(27)36-2)30-14-12-26(24)37-23-10-8-21(9-11-23)31-29(34)32-22-13-15-33(19-22)18-20-6-4-3-5-7-20/h3-12,14,16-17,22H,13,15,18-19H2,1-2H3,(H2,31,32,34)/t22-/m0/s1 |
| InChIKey | LFRHACDLCGAGPD-QFIPXVFZSA-N |
| XLogP | 5.44 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |