C18H19Cl2N3O — CID 24528876
1-(1-benzylpyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 24528876) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-(1-benzylpyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(1-benzylpyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 24528876 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 1-(1-benzylpyrrolidin-3-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)NC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H19Cl2N3O/c19-16-7-6-14(10-17(16)20)21-18(24)22-15-8-9-23(12-15)11-13-4-2-1-3-5-13/h1-7,10,15H,8-9,11-12H2,(H2,21,22,24) |
| InChIKey | QABBWCBZTLWYKF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |