C21H25Cl2N5O2 — CID 18871059
1-[3-(4-benzylpiperazin-1-yl)propanoylamino]-3-(3,4-dichlorophenyl)urea (PubChem CID 18871059) has the molecular formula C21H25Cl2N5O2 and a molecular weight of 450.37 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propanoylamino]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propanoylamino]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 18871059 |
| Molecular Formula | C21H25Cl2N5O2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propanoylamino]-3-(3,4-dichlorophenyl)urea |
| SMILES | O=C(CCN1CCN(Cc2ccccc2)CC1)NNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H25Cl2N5O2/c22-18-7-6-17(14-19(18)23)24-21(30)26-25-20(29)8-9-27-10-12-28(13-11-27)15-16-4-2-1-3-5-16/h1-7,14H,8-13,15H2,(H,25,29)(H2,24,26,30) |
| InChIKey | RDKBOICQTRUGFC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|