C22H27FN4O2 — CID 4869354
3-(4-benzylpiperazin-1-yl)-N'-[2-(2-fluorophenyl)acetyl]propanehydrazide (PubChem CID 4869354) has the molecular formula C22H27FN4O2 and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-(4-benzylpiperazin-1-yl)-N'-[2-(2-fluorophenyl)acetyl]propanehydrazide.
| Compound Name | 3-(4-benzylpiperazin-1-yl)-N'-[2-(2-fluorophenyl)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 4869354 |
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-(4-benzylpiperazin-1-yl)-N'-[2-(2-fluorophenyl)acetyl]propanehydrazide |
| SMILES | O=C(CCN1CCN(Cc2ccccc2)CC1)NNC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C22H27FN4O2/c23-20-9-5-4-8-19(20)16-22(29)25-24-21(28)10-11-26-12-14-27(15-13-26)17-18-6-2-1-3-7-18/h1-9H,10-17H2,(H,24,28)(H,25,29) |
| InChIKey | KAUIXXNPIBDABA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|