C24H35FIN5 — CID 111266646
1-[4-(4-benzylpiperazin-1-yl)butyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111266646) has the molecular formula C24H35FIN5 and a molecular weight of 539.48 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111266646 |
| Molecular Formula | C24H35FIN5 |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-[(2-fluorophenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCCCN1CCN(Cc2ccccc2)CC1)NCc1ccccc1F.I |
| InChI | InChI=1S/C24H34FN5.HI/c1-26-24(28-19-22-11-5-6-12-23(22)25)27-13-7-8-14-29-15-17-30(18-16-29)20-21-9-3-2-4-10-21;/h2-6,9-12H,7-8,13-20H2,1H3,(H2,26,27,28);1H |
| InChIKey | UEFGKGLGTLQKBW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|