C21H27FN4 — CID 110986480
1-(1-benzylpiperidin-4-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine (PubChem CID 110986480) has the molecular formula C21H27FN4 and a molecular weight of 354.47 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110986480 |
| Molecular Formula | C21H27FN4 |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(2-fluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccccc1F)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27FN4/c1-23-21(24-15-18-9-5-6-10-20(18)22)25-19-11-13-26(14-12-19)16-17-7-3-2-4-8-17/h2-10,19H,11-16H2,1H3,(H2,23,24,25) |
| InChIKey | KNNWPEFNBHVOMY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|