C22H30ClIN4 — CID 110987549
1-(1-benzylpiperidin-4-yl)-3-[2-(2-chlorophenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110987549) has the molecular formula C22H30ClIN4 and a molecular weight of 512.87 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[2-(2-chlorophenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(2-chlorophenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110987549 |
| Molecular Formula | C22H30ClIN4 |
| Molecular Weight | 512.87 g/mol |
| Exact Mass | 512.12 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(2-chlorophenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccc1Cl)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C22H29ClN4.HI/c1-24-22(25-14-11-19-9-5-6-10-21(19)23)26-20-12-15-27(16-13-20)17-18-7-3-2-4-8-18;/h2-10,20H,11-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | YLQSEVYKCXUZPW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|