C25H37IN4O — CID 110987479
1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 110987479) has the molecular formula C25H37IN4O and a molecular weight of 536.50 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110987479 |
| Molecular Formula | C25H37IN4O |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-(2-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCCc1ccccc1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C25H36N4O.HI/c1-26-25(27-16-8-19-30-20-15-22-9-4-2-5-10-22)28-24-13-17-29(18-14-24)21-23-11-6-3-7-12-23;/h2-7,9-12,24H,8,13-21H2,1H3,(H2,26,27,28);1H |
| InChIKey | COHLUXQOVPEFKD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|