C27H41IN4O — CID 110987167
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(2-phenylethoxy)butyl]guanidine;hydroiodide (PubChem CID 110987167) has the molecular formula C27H41IN4O and a molecular weight of 564.56 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(2-phenylethoxy)butyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(2-phenylethoxy)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110987167 |
| Molecular Formula | C27H41IN4O |
| Molecular Weight | 564.56 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(2-phenylethoxy)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCOCCc1ccccc1)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C27H40N4O.HI/c1-2-28-27(29-18-9-10-21-32-22-17-24-11-5-3-6-12-24)30-26-15-19-31(20-16-26)23-25-13-7-4-8-14-25;/h3-8,11-14,26H,2,9-10,15-23H2,1H3,(H2,28,29,30);1H |
| InChIKey | QRCJTBOWJLOMFL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|