C21H27BrN4 — CID 110986550
1-(1-benzylpiperidin-4-yl)-3-[(3-bromophenyl)methyl]-2-methylguanidine (PubChem CID 110986550) has the molecular formula C21H27BrN4 and a molecular weight of 415.38 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[(3-bromophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[(3-bromophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110986550 |
| Molecular Formula | C21H27BrN4 |
| Molecular Weight | 415.38 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[(3-bromophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1cccc(Br)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H27BrN4/c1-23-21(24-15-18-8-5-9-19(22)14-18)25-20-10-12-26(13-11-20)16-17-6-3-2-4-7-17/h2-9,14,20H,10-13,15-16H2,1H3,(H2,23,24,25) |
| InChIKey | XIIQBWLZPHZBFR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|