C22H26F2IN5 — CID 111992392
1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide (PubChem CID 111992392) has the molecular formula C22H26F2IN5 and a molecular weight of 525.39 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111992392 |
| Molecular Formula | C22H26F2IN5 |
| Molecular Weight | 525.39 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(C#N)ccc1F)NC1CCN(Cc2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C22H25F2N5.HI/c1-26-22(27-14-18-12-17(13-25)4-7-21(18)24)28-20-8-10-29(11-9-20)15-16-2-5-19(23)6-3-16;/h2-7,12,20H,8-11,14-15H2,1H3,(H2,26,27,28);1H |
| InChIKey | FXQGMCBFPGWFCS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|