C22H27FIN5 — CID 111768236
1-[(4-cyano-2-fluorophenyl)methyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111768236) has the molecular formula C22H27FIN5 and a molecular weight of 507.40 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111768236 |
| Molecular Formula | C22H27FIN5 |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-2-methyl-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCC2)cc1)NCc1ccc(C#N)cc1F.I |
| InChI | InChI=1S/C22H26FN5.HI/c1-25-22(27-15-20-9-8-19(13-24)12-21(20)23)26-14-17-4-6-18(7-5-17)16-28-10-2-3-11-28;/h4-9,12H,2-3,10-11,14-16H2,1H3,(H2,25,26,27);1H |
| InChIKey | ODXVLSMAMDZIAG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 63.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|