C22H33IN4O — CID 111580526
1-[(2,5-dimethylfuran-3-yl)methyl]-2-methyl-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111580526) has the molecular formula C22H33IN4O and a molecular weight of 496.44 g/mol. Its IUPAC name is 1-[(2,5-dimethylfuran-3-yl)methyl]-2-methyl-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-2-methyl-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111580526 |
| Molecular Formula | C22H33IN4O |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-[(2,5-dimethylfuran-3-yl)methyl]-2-methyl-3-[[4-(piperidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(CN2CCCCC2)cc1)NCc1cc(C)oc1C.I |
| InChI | InChI=1S/C22H32N4O.HI/c1-17-13-21(18(2)27-17)15-25-22(23-3)24-14-19-7-9-20(10-8-19)16-26-11-5-4-6-12-26;/h7-10,13H,4-6,11-12,14-16H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | CGMHZCSIZUPSJT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|