C18H18F2N4 — CID 111763601
1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111763601) has the molecular formula C18H18F2N4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111763601 |
| Molecular Formula | C18H18F2N4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-[(4-cyano-2-fluorophenyl)methyl]-3-[2-(4-fluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCc1ccc(F)cc1)NCc1ccc(C#N)cc1F |
| InChI | InChI=1S/C18H18F2N4/c1-22-18(23-9-8-13-3-6-16(19)7-4-13)24-12-15-5-2-14(11-21)10-17(15)20/h2-7,10H,8-9,12H2,1H3,(H2,22,23,24) |
| InChIKey | OYCQLMDGNYEMTN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|