C22H28FIN4O2 — CID 111498433
1-[(5-cyano-2-fluorophenyl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111498433) has the molecular formula C22H28FIN4O2 and a molecular weight of 526.39 g/mol. Its IUPAC name is 1-[(5-cyano-2-fluorophenyl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111498433 |
| Molecular Formula | C22H28FIN4O2 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 1-[(5-cyano-2-fluorophenyl)methyl]-3-[2-(3,4-diethoxyphenyl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCOc1ccc(CCN/C(=N/C)NCc2cc(C#N)ccc2F)cc1OCC.I |
| InChI | InChI=1S/C22H27FN4O2.HI/c1-4-28-20-9-7-16(13-21(20)29-5-2)10-11-26-22(25-3)27-15-18-12-17(14-24)6-8-19(18)23;/h6-9,12-13H,4-5,10-11,15H2,1-3H3,(H2,25,26,27);1H |
| InChIKey | XQGIVXYTFVHGGI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|