C17H19F2N3 — CID 111780718
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine (PubChem CID 111780718) has the molecular formula C17H19F2N3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111780718 |
| Molecular Formula | C17H19F2N3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-phenylethyl)guanidine |
| SMILES | C/N=C(\NCCc1ccccc1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C17H19F2N3/c1-20-17(21-10-9-13-5-3-2-4-6-13)22-12-14-11-15(18)7-8-16(14)19/h2-8,11H,9-10,12H2,1H3,(H2,20,21,22) |
| InChIKey | QIBTYQYWEJFKLT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|