C14H21F2N3 — CID 111548269
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(3-methylbutyl)guanidine (PubChem CID 111548269) has the molecular formula C14H21F2N3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(3-methylbutyl)guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(3-methylbutyl)guanidine |
|---|---|
| PubChem CID | 111548269 |
| Molecular Formula | C14H21F2N3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(3-methylbutyl)guanidine |
| SMILES | C/N=C(\NCCC(C)C)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H21F2N3/c1-10(2)6-7-18-14(17-3)19-9-11-8-12(15)4-5-13(11)16/h4-5,8,10H,6-7,9H2,1-3H3,(H2,17,18,19) |
| InChIKey | DIIYSZNTJKEJJG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|