C12H18F2IN3O2S — CID 111903148
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111903148) has the molecular formula C12H18F2IN3O2S and a molecular weight of 433.26 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111903148 |
| Molecular Formula | C12H18F2IN3O2S |
| Molecular Weight | 433.26 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCc1cc(F)ccc1F.I |
| InChI | InChI=1S/C12H17F2N3O2S.HI/c1-15-12(16-5-6-20(2,18)19)17-8-9-7-10(13)3-4-11(9)14;/h3-4,7H,5-6,8H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | POVMFJQTBHCLPK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|