C15H22F2N4O3S — CID 111902403
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111902403) has the molecular formula C15H22F2N4O3S and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111902403 |
| Molecular Formula | C15H22F2N4O3S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-(2-morpholin-4-ylsulfonylethyl)guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)N1CCOCC1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H22F2N4O3S/c1-18-15(20-11-12-10-13(16)2-3-14(12)17)19-4-9-25(22,23)21-5-7-24-8-6-21/h2-3,10H,4-9,11H2,1H3,(H2,18,19,20) |
| InChIKey | ORBFXTLOXVDOAO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|