C21H25ClF2N4O — CID 111902135
1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine (PubChem CID 111902135) has the molecular formula C21H25ClF2N4O and a molecular weight of 422.91 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111902135 |
| Molecular Formula | C21H25ClF2N4O |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-3-[(2,5-difluorophenyl)methyl]-2-methylguanidine |
| SMILES | C/N=C(/NCc1cc(F)ccc1F)NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H25ClF2N4O/c1-25-21(26-13-16-12-18(23)6-7-19(16)24)27-14-20(28-8-10-29-11-9-28)15-2-4-17(22)5-3-15/h2-7,12,20H,8-11,13-14H2,1H3,(H2,25,26,27) |
| InChIKey | HMRHTAFVOXGNNR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|