C20H32ClN5O2 — CID 111087097
1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine (PubChem CID 111087097) has the molecular formula C20H32ClN5O2 and a molecular weight of 409.96 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine.
| Compound Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
|---|---|
| PubChem CID | 111087097 |
| Molecular Formula | C20H32ClN5O2 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-morpholin-4-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCOCC1)NCC(c1ccc(Cl)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H32ClN5O2/c1-22-20(23-6-7-25-8-12-27-13-9-25)24-16-19(26-10-14-28-15-11-26)17-2-4-18(21)5-3-17/h2-5,19H,6-16H2,1H3,(H2,22,23,24) |
| InChIKey | RVHKMYDYTHLING-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|