C21H34ClN5O — CID 111415281
1-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine (PubChem CID 111415281) has the molecular formula C21H34ClN5O and a molecular weight of 407.99 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine.
| Compound Name | 1-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111415281 |
| Molecular Formula | C21H34ClN5O |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-piperidin-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCCN1CCCCC1)NCC(c1cccc(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C21H34ClN5O/c1-23-21(24-8-11-26-9-3-2-4-10-26)25-17-20(27-12-14-28-15-13-27)18-6-5-7-19(22)16-18/h5-7,16,20H,2-4,8-15,17H2,1H3,(H2,23,24,25) |
| InChIKey | MDYVLTNJMNXEMO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|