C22H29F2IN4O — CID 111783938
1-[(2,5-difluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111783938) has the molecular formula C22H29F2IN4O and a molecular weight of 530.40 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111783938 |
| Molecular Formula | C22H29F2IN4O |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(F)ccc1F)NCC(c1ccc(OC)cc1)N1CCCC1.I |
| InChI | InChI=1S/C22H28F2N4O.HI/c1-25-22(26-14-17-13-18(23)7-10-20(17)24)27-15-21(28-11-3-4-12-28)16-5-8-19(29-2)9-6-16;/h5-10,13,21H,3-4,11-12,14-15H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | UPPDOOUKTGDHHS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|