C15H20F2N4O — CID 111902137
N-[2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide (PubChem CID 111902137) has the molecular formula C15H20F2N4O and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 111902137 |
| Molecular Formula | C15H20F2N4O |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | N-[2-[[N-[(2,5-difluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide |
| SMILES | C/N=C(\NCCNC(=O)C1CC1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C15H20F2N4O/c1-18-15(20-7-6-19-14(22)10-2-3-10)21-9-11-8-12(16)4-5-13(11)17/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | XARVXNUKFKFDQF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|