C13H19F2N3O2S — CID 111902871
1-[(2,5-difluorophenyl)methyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine (PubChem CID 111902871) has the molecular formula C13H19F2N3O2S and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111902871 |
| Molecular Formula | C13H19F2N3O2S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-3-(2-ethylsulfonylethyl)-2-methylguanidine |
| SMILES | CCS(=O)(=O)CCN/C(=N\C)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2N3O2S/c1-3-21(19,20)7-6-17-13(16-2)18-9-10-8-11(14)4-5-12(10)15/h4-5,8H,3,6-7,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | PQNDUMMNCBOTOS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|