C14H16F2N4O2S2 — CID 111901495
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111901495) has the molecular formula C14H16F2N4O2S2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111901495 |
| Molecular Formula | C14H16F2N4O2S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C14H16F2N4O2S2/c1-18-14(19-7-9-6-10(15)2-4-12(9)16)20-8-11-3-5-13(23-11)24(17,21)22/h2-6H,7-8H2,1H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | FJPMGULZACSQPM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|