C10H19IN4O2S2 — CID 111124758
2-methyl-1-propan-2-yl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111124758) has the molecular formula C10H19IN4O2S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is 2-methyl-1-propan-2-yl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-propan-2-yl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111124758 |
| Molecular Formula | C10H19IN4O2S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.00 |
| IUPAC Name | 2-methyl-1-propan-2-yl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(N)(=O)=O)s1)NC(C)C.I |
| InChI | InChI=1S/C10H18N4O2S2.HI/c1-7(2)14-10(12-3)13-6-8-4-5-9(17-8)18(11,15)16;/h4-5,7H,6H2,1-3H3,(H2,11,15,16)(H2,12,13,14);1H |
| InChIKey | FNWNPCLOXNMMOQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|