C15H24IN5O3S2 — CID 111593970
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111593970) has the molecular formula C15H24IN5O3S2 and a molecular weight of 513.43 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111593970 |
| Molecular Formula | C15H24IN5O3S2 |
| Molecular Weight | 513.43 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(C(C)(C)C)o1)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C15H23N5O3S2.HI/c1-15(2,3)11-8-18-12(23-11)9-20-14(17-4)19-7-10-5-6-13(24-10)25(16,21)22;/h5-6,8H,7,9H2,1-4H3,(H2,16,21,22)(H2,17,19,20);1H |
| InChIKey | IMMBMEPZZUNKPR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|