C16H25IN6O — CID 119140590
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 119140590) has the molecular formula C16H25IN6O and a molecular weight of 444.32 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119140590 |
| Molecular Formula | C16H25IN6O |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(2-methylpyrimidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccnc(C)n1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C16H24N6O.HI/c1-11-18-7-6-12(22-11)8-20-15(17-5)21-10-14-19-9-13(23-14)16(2,3)4;/h6-7,9H,8,10H2,1-5H3,(H2,17,20,21);1H |
| InChIKey | MBIKBCPOQQDVJK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|