C18H26ClIN4O2 — CID 111595241
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenoxy)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111595241) has the molecular formula C18H26ClIN4O2 and a molecular weight of 492.79 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenoxy)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenoxy)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111595241 |
| Molecular Formula | C18H26ClIN4O2 |
| Molecular Weight | 492.79 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(4-chlorophenoxy)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCCOc1ccc(Cl)cc1)NCc1ncc(C(C)(C)C)o1.I |
| InChI | InChI=1S/C18H25ClN4O2.HI/c1-18(2,3)15-11-22-16(25-15)12-23-17(20-4)21-9-10-24-14-7-5-13(19)6-8-14;/h5-8,11H,9-10,12H2,1-4H3,(H2,20,21,23);1H |
| InChIKey | MHRFSTULEJAPHF-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.79 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|