C16H30N4O2 — CID 111593296
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine (PubChem CID 111593296) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111593296 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[2-(2-methylpropoxy)ethyl]guanidine |
| SMILES | C/N=C(\NCCOCC(C)C)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C16H30N4O2/c1-12(2)11-21-8-7-18-15(17-6)20-10-14-19-9-13(22-14)16(3,4)5/h9,12H,7-8,10-11H2,1-6H3,(H2,17,18,20) |
| InChIKey | IRGPOADPVNLXGO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|