C15H28N4O3 — CID 111592647
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine (PubChem CID 111592647) has the molecular formula C15H28N4O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111592647 |
| Molecular Formula | C15H28N4O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2-methoxyethoxy)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCOCCOC)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C15H28N4O3/c1-15(2,3)12-10-18-13(22-12)11-19-14(16-4)17-6-7-21-9-8-20-5/h10H,6-9,11H2,1-5H3,(H2,16,17,19) |
| InChIKey | GYZLQSWGKAWUJT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|