C18H24F2N4O — CID 111594426
1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine (PubChem CID 111594426) has the molecular formula C18H24F2N4O and a molecular weight of 350.41 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111594426 |
| Molecular Formula | C18H24F2N4O |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-3-[2-(2,6-difluorophenyl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c(F)cccc1F)NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C18H24F2N4O/c1-18(2,3)15-10-23-16(25-15)11-24-17(21-4)22-9-8-12-13(19)6-5-7-14(12)20/h5-7,10H,8-9,11H2,1-4H3,(H2,21,22,24) |
| InChIKey | XIDQQYXJEWPZPT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|