C19H27F2IN4O — CID 111593505
2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(2,6-difluorophenyl)ethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111593505) has the molecular formula C19H27F2IN4O and a molecular weight of 492.35 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(2,6-difluorophenyl)ethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(2,6-difluorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111593505 |
| Molecular Formula | C19H27F2IN4O |
| Molecular Weight | 492.35 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 2-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-1-[2-(2,6-difluorophenyl)ethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCc1c(F)cccc1F.I |
| InChI | InChI=1S/C19H26F2N4O.HI/c1-5-22-18(23-10-9-13-14(20)7-6-8-15(13)21)25-12-17-24-11-16(26-17)19(2,3)4;/h6-8,11H,5,9-10,12H2,1-4H3,(H2,22,23,25);1H |
| InChIKey | ZBVDYRNSUPROMC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|