C21H31FIN5O2 — CID 111594321
N-[2-[[N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111594321) has the molecular formula C21H31FIN5O2 and a molecular weight of 531.41 g/mol. Its IUPAC name is N-[2-[[N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111594321 |
| Molecular Formula | C21H31FIN5O2 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | N-[2-[[N'-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-N-ethylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(C(C)(C)C)o1)NCCNC(=O)c1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C21H30FN5O2.HI/c1-6-23-20(27-13-18-26-12-17(29-18)21(3,4)5)25-10-9-24-19(28)15-8-7-14(2)16(22)11-15;/h7-8,11-12H,6,9-10,13H2,1-5H3,(H,24,28)(H2,23,25,27);1H |
| InChIKey | IWTJLOUJWMQLCD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|