C21H30FIN4O3 — CID 111664236
N-[2-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111664236) has the molecular formula C21H30FIN4O3 and a molecular weight of 532.40 g/mol. Its IUPAC name is N-[2-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111664236 |
| Molecular Formula | C21H30FIN4O3 |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | N-[2-[[N-ethyl-N'-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]carbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCNC(=O)c1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C21H29FN4O3.HI/c1-5-23-20(26-13-21(4,28)18-9-7-15(3)29-18)25-11-10-24-19(27)16-8-6-14(2)17(22)12-16;/h6-9,12,28H,5,10-11,13H2,1-4H3,(H,24,27)(H2,23,25,26);1H |
| InChIKey | KULMMICOWOOQEZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|