C20H30IN3O3 — CID 111664468
1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-(3-methylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 111664468) has the molecular formula C20H30IN3O3 and a molecular weight of 487.38 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-(3-methylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-(3-methylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111664468 |
| Molecular Formula | C20H30IN3O3 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-(3-methylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCOc1cccc(C)c1.I |
| InChI | InChI=1S/C20H29N3O3.HI/c1-5-21-19(22-11-12-25-17-8-6-7-15(2)13-17)23-14-20(4,24)18-10-9-16(3)26-18;/h6-10,13,24H,5,11-12,14H2,1-4H3,(H2,21,22,23);1H |
| InChIKey | AQJKBFHQOWZXED-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|