C22H31IN4O4 — CID 111663908
1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide (PubChem CID 111663908) has the molecular formula C22H31IN4O4 and a molecular weight of 542.42 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111663908 |
| Molecular Formula | C22H31IN4O4 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCOc1ccc2c(c1)CCC(=O)N2.I |
| InChI | InChI=1S/C22H30N4O4.HI/c1-4-23-21(25-14-22(3,28)19-9-5-15(2)30-19)24-11-12-29-17-7-8-18-16(13-17)6-10-20(27)26-18;/h5,7-9,13,28H,4,6,10-12,14H2,1-3H3,(H,26,27)(H2,23,24,25);1H |
| InChIKey | OTVKJYOFDUZBNO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|