C15H28IN3O4S — CID 111664532
1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide (PubChem CID 111664532) has the molecular formula C15H28IN3O4S and a molecular weight of 473.38 g/mol. Its IUPAC name is 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111664532 |
| Molecular Formula | C15H28IN3O4S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C15H27N3O4S.HI/c1-5-16-14(17-9-10-23(20,21)6-2)18-11-15(4,19)13-8-7-12(3)22-13;/h7-8,19H,5-6,9-11H2,1-4H3,(H2,16,17,18);1H |
| InChIKey | BMCJDEKNJQASNB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|