C17H30N4O4S — CID 111664473
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine (PubChem CID 111664473) has the molecular formula C17H30N4O4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111664473 |
| Molecular Formula | C17H30N4O4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1ccc(C)o1)NCCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H30N4O4S/c1-4-18-16(19-7-8-21-9-11-26(23,24)12-10-21)20-13-17(3,22)15-6-5-14(2)25-15/h5-6,22H,4,7-13H2,1-3H3,(H2,18,19,20) |
| InChIKey | ZFASJPVQGKTRMR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|