C16H31IN6O3S — CID 111657087
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111657087) has the molecular formula C16H31IN6O3S and a molecular weight of 514.43 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111657087 |
| Molecular Formula | C16H31IN6O3S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCN1CCS(=O)(=O)CC1.I |
| InChI | InChI=1S/C16H30N6O3S.HI/c1-4-17-15(18-5-6-22-7-9-26(24,25)10-8-22)19-13-16(2,23)14-11-20-21(3)12-14;/h11-12,23H,4-10,13H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | ZPPSKBPMYXNBPB-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|