C15H31IN6O — CID 111656533
1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111656533) has the molecular formula C15H31IN6O and a molecular weight of 438.36 g/mol. Its IUPAC name is 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111656533 |
| Molecular Formula | C15H31IN6O |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 1-ethyl-3-[2-[ethyl(methyl)amino]ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCN(C)CC.I |
| InChI | InChI=1S/C15H30N6O.HI/c1-6-16-14(17-8-9-20(4)7-2)18-12-15(3,22)13-10-19-21(5)11-13;/h10-11,22H,6-9,12H2,1-5H3,(H2,16,17,18);1H |
| InChIKey | CONQZFMYBFOZAW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|