C20H36N6O3 — CID 111655982
tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate (PubChem CID 111655982) has the molecular formula C20H36N6O3 and a molecular weight of 408.55 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 111655982 |
| Molecular Formula | C20H36N6O3 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]ethyl]carbamate |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCN(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C20H36N6O3/c1-7-21-17(23-14-20(5,28)15-12-24-25(6)13-15)22-10-11-26(16-8-9-16)18(27)29-19(2,3)4/h12-13,16,28H,7-11,14H2,1-6H3,(H2,21,22,23) |
| InChIKey | SSTHOKHNRFFBRI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|