C20H37N7O2 — CID 111656902
1-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 111656902) has the molecular formula C20H37N7O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | 1-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 111656902 |
| Molecular Formula | C20H37N7O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCCN1CCCC1C(=O)N(C)C |
| InChI | InChI=1S/C20H37N7O2/c1-6-21-19(23-15-20(2,29)16-13-24-26(5)14-16)22-10-8-12-27-11-7-9-17(27)18(28)25(3)4/h13-14,17,29H,6-12,15H2,1-5H3,(H2,21,22,23) |
| InChIKey | OAUPRNCOMPUMRW-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|