C18H38IN5OS — CID 111611725
1-[3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide (PubChem CID 111611725) has the molecular formula C18H38IN5OS and a molecular weight of 499.51 g/mol. Its IUPAC name is 1-[3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide.
| Compound Name | 1-[3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111611725 |
| Molecular Formula | C18H38IN5OS |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 1-[3-[[N-ethyl-N'-(2-methyl-2-methylsulfanylpropyl)carbamimidoyl]amino]propyl]-N,N-dimethylpyrrolidine-2-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(C)SC)NCCCN1CCCC1C(=O)N(C)C.I |
| InChI | InChI=1S/C18H37N5OS.HI/c1-7-19-17(21-14-18(2,3)25-6)20-11-9-13-23-12-8-10-15(23)16(24)22(4)5;/h15H,7-14H2,1-6H3,(H2,19,20,21);1H |
| InChIKey | DDMRTHAARITNRZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|