C17H32N6O — CID 111655784
1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine (PubChem CID 111655784) has the molecular formula C17H32N6O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine.
| Compound Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111655784 |
| Molecular Formula | C17H32N6O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.26 |
| IUPAC Name | 1-ethyl-3-[(1-ethylpyrrolidin-2-yl)methyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCC1CCCN1CC |
| InChI | InChI=1S/C17H32N6O/c1-5-18-16(19-11-15-8-7-9-23(15)6-2)20-13-17(3,24)14-10-21-22(4)12-14/h10,12,15,24H,5-9,11,13H2,1-4H3,(H2,18,19,20) |
| InChIKey | BXIUGGXOKVKMQI-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 77.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|