C21H37IN4O — CID 109417833
1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 109417833) has the molecular formula C21H37IN4O and a molecular weight of 488.46 g/mol. Its IUPAC name is 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109417833 |
| Molecular Formula | C21H37IN4O |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 1-ethyl-2-(2-hydroxy-2-phenylpropyl)-3-[[(2R)-1-(2-methylpropyl)pyrrolidin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)(O)c1ccccc1)NC[C@H]1CCCN1CC(C)C.I |
| InChI | InChI=1S/C21H36N4O.HI/c1-5-22-20(23-14-19-12-9-13-25(19)15-17(2)3)24-16-21(4,26)18-10-7-6-8-11-18;/h6-8,10-11,17,19,26H,5,9,12-16H2,1-4H3,(H2,22,23,24);1H/t19-,21?;/m1./s1 |
| InChIKey | XDDMZGUWFJDYLW-YYNYCHCGSA-N |
| XLogP | 3.19 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|